G 476 structure
|
Common Name | G 476 | ||
|---|---|---|---|---|
| CAS Number | 21332-83-2 | Molecular Weight | 302.75600 | |
| Density | 1.374g/cm3 | Boiling Point | 535.1ºC at 760 mmHg | |
| Molecular Formula | C16H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.4ºC | |
| Name | 2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethanol |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 535.1ºC at 760 mmHg |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.75600 |
| Flash Point | 277.4ºC |
| Exact Mass | 302.08200 |
| PSA | 54.38000 |
| LogP | 3.52720 |
| Vapour Pressure | 2.8E-12mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | YLWSSEWYRMDPDD-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCO)c2c1 |
|
~90%
G 476 CAS#:21332-83-2 |
| Literature: Leon; Garbay-Jaureguiberry; Lambert; Le Pecq; Rogues Journal of Medicinal Chemistry, 1988 , vol. 31, # 5 p. 1021 - 1026 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |