5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol
Modify Date: 2026-08-22 18:21:16
![5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol Structure](https://www.chemsrc.com/extcaspic/048/213327-91-4.png)
5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol structure
|
Common Name | 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol | ||
|---|---|---|---|---|
| CAS Number | 213327-91-4 | Molecular Weight | 338.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H26O2Si |
|---|---|
| Molecular Weight | 338.5 |
| InChIKey | PMLYQHHJQSAPJY-UHFFFAOYSA-N |
| SMILES | CC(O)C#CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 213327-91-4? |
| A: Chinese name of 213327-91-4 is 213327-91-4. |
| Q: What is the molecular weight of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: Molecular weight of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is 338.5. |
| Q: What is the CAS number of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: CAS number of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is 213327-91-4. |
| Q: What is the SMILES notation of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: SMILES notation of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is CC(O)C#CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C. |
| Q: What is the English name of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: The English name of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol. |
| Q: What is the molecular formula of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: Molecular formula of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is C21H26O2Si. |
| Q: What is the InChIKey of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol? |
| A: InChIKey of 5-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-3-pentyn-2-ol is PMLYQHHJQSAPJY-UHFFFAOYSA-N. |