Montelukast Dicarboxylic Acid(Mixture of DiastereoMers) structure
|
Common Name | Montelukast Dicarboxylic Acid(Mixture of DiastereoMers) | ||
|---|---|---|---|---|
| CAS Number | 213380-27-9 | Molecular Weight | 616.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H34ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[(3R)-3-[[1-(carboxymethyl)cyclopropyl]methylsulfanyl]-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]phenyl]-2-hydroxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C35H34ClNO5S |
|---|---|
| Molecular Weight | 616.16600 |
| Exact Mass | 615.18500 |
| PSA | 133.02000 |
| LogP | 8.01270 |
| InChIKey | FJSYYPGNUBZDIM-VZLZVWCJSA-N |
| SMILES | CC(O)(C(=O)O)c1ccccc1CCC(SCC1(CC(=O)O)CC1)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| Montelukast Dicarboxylic Acid(Mixture of Diastereomers) |
| UNII-67LX7DAR3J |
| 2-[(3R)-3-[[[1-(Carboxymethyl)cyclopropyl]methyl]thio]-3-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]propyl]-|A-hydroxy-|A-methylbenzeneacetic Acid |