2',3'-cGAMP-C2-SH structure
|
Common Name | 2',3'-cGAMP-C2-SH | ||
|---|---|---|---|---|
| CAS Number | 2133823-39-7 | Molecular Weight | 718.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N10O12P2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2',3'-cGAMP-C2-SH2',3'-cGAMP-C2-SH is a ADC cytotoxin that is extracted from patent US20210015941, example 24[1]. |
| Name | 2',3'-cGAMP-C2-SH |
|---|
| Description | 2',3'-cGAMP-C2-SH is a ADC cytotoxin that is extracted from patent US20210015941, example 24[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 2',3'-cGAMP-C2-SH is a toxin molecule that can be used to synthesize ADCs[1]. |
| References |
[1]. US20210015941 |
| Molecular Formula | C22H28N10O12P2S |
|---|---|
| Molecular Weight | 718.53 |
| InChIKey | WKFFSEOIKYTXCF-QXBAVTJVSA-N |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC4C(COP(=O)(O)OC2C3CCS)OC(n2cnc3c(N)ncnc32)C4O)c(=O)[nH]1 |