3-(5-carboxy-2-hydroxy-3-methoxy-phenyl)-4-hydroxy-5-methoxy-benzoic a cid structure
|
Common Name | 3-(5-carboxy-2-hydroxy-3-methoxy-phenyl)-4-hydroxy-5-methoxy-benzoic a cid | ||
|---|---|---|---|---|
| CAS Number | 2134-90-9 | Molecular Weight | 334.27800 | |
| Density | 1.488g/cm3 | Boiling Point | 587.7ºC at 760 mmHg | |
| Molecular Formula | C16H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | 3-(5-carboxy-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760 mmHg |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.27800 |
| Flash Point | 219.1ºC |
| Exact Mass | 334.06900 |
| PSA | 133.52000 |
| LogP | 2.17840 |
| Vapour Pressure | 1.18E-14mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | QGCWGSXMGCSFDM-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc(-c2cc(C(=O)O)cc(OC)c2O)c1O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5,5'-dehydrodivanillate |
| 6,6'-Dihydroxy-5,5'-dimethoxy-biphenyl-3,3'-dicarbonsaeure |
| 6,6'-dihydroxy-5,5'-dimethoxy-biphenyl-3,3'-dicarboxylic acid |
| Dehydrodivanillinsaeure |