orthosulfamuron structure
|
Common Name | orthosulfamuron | ||
|---|---|---|---|---|
| CAS Number | 213464-77-8 | Molecular Weight | 424.43200 | |
| Density | 1.466g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H20N6O6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | orthosulfamuron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Molecular Formula | C16H20N6O6S |
| Molecular Weight | 424.43200 |
| Exact Mass | 424.11700 |
| PSA | 160.23000 |
| LogP | 2.29170 |
| Index of Refraction | 1.624 |
| InChIKey | UCDPMNSCCRBWIC-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)Nc2ccccc2C(=O)N(C)C)n1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2935009015 |
| HS Code | 2935009015 |
|---|---|
| Summary | 2935009015 n-(2,4-dimethyl-5-(trifluoromethylsulfonamido)phenyl)acetamide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:35.0% |
| 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]-N,N-dimethylbenzamide |
| 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}amino)-N,N-dimethylbenzamide |
| Orthosulfamuron |
| 1-(4,6-dimethoxypyrimidin-2-yl)-3-[2-(dimethylcarbamoyl)phenylsulfamoyl]urea |
| 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]amino]-N,N-dimethylbenzamide |