[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxypropyl] methanesulfonate structure
|
Common Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxypropyl] methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 213475-70-8 | Molecular Weight | 347.40600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxypropyl] methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21NO8S2 |
|---|---|
| Molecular Weight | 347.40600 |
| Exact Mass | 347.07100 |
| PSA | 141.83000 |
| LogP | 2.38460 |
| InChIKey | OQZLCYFJSRPMBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(COS(C)(=O)=O)COS(C)(=O)=O |
| HS Code | 2924199090 |
|---|
|
~88%
[2-[(2-methylpr... CAS#:213475-70-8 |
| Literature: Nguyen, Kong Thong; Luethi, Erika; Syed, Salahuddin; Urwyler, Stephan; Bertrand, Sonia; Bertrand, Daniel; Reymond, Jean-Louis Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 14 p. 3832 - 3835 |
|
~%
[2-[(2-methylpr... CAS#:213475-70-8 |
| Literature: Benoist, Eric; Loussouarn, Anthony; Remaud, Patricia; Chatal, Jean-Francois; Gestin, Jean-Francois Synthesis, 1998 , # 8 p. 1113 - 1118 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Boc-serinol dimesylate |
| N-(tert-butyloxycarbonyl)-2-amino-1,3-propanediol dimesylate |
| bis-(methanesulfonic acid ester) of boc-serinol |
| 2-(tert-butoxycarbonylamino)propane-1,3-diyl dimethanesulfonate |
| Y8240 |
| methanesulfonic acid 2-tert-butoxycarbonylamino-3-methanesulfonyloxypropylester |
| tert-butyl N-[1,3-bis(methanesulfonyloxy)propan-2-yl]carbamate |