(S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl
Modify Date: 2025-09-05 12:48:37
(S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl structure
|
Common Name | (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl | ||
|---|---|---|---|---|
| CAS Number | 2135331-61-0 | Molecular Weight | 225.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClN3O |
|---|---|
| Molecular Weight | 225.67 |
| InChIKey | MPSNKBIQPBHLBW-FJXQXJEOSA-N |
| SMILES | CC(N)c1nnc(-c2ccccc2)o1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: SMILES notation of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is CC(N)c1nnc(-c2ccccc2)o1.Cl. |
| Q: What is the InChIKey of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: InChIKey of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is MPSNKBIQPBHLBW-FJXQXJEOSA-N. |
| Q: What is the molecular weight of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: Molecular weight of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is 225.67. |
| Q: What is the English name of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: The English name of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl. |
| Q: What is the Chinese name of 2135331-61-0? |
| A: Chinese name of 2135331-61-0 is 2135331-61-0. |
| Q: What is the molecular formula of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: Molecular formula of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is C10H12ClN3O. |
| Q: What is the CAS number of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl? |
| A: CAS number of (S)-1-(5-Phenyl-1,3,4-oxadiazol-2-YL)ethan-1-amine hcl is 2135331-61-0. |