1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl
Modify Date: 2026-07-06 10:26:35
![1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl Structure](https://www.chemsrc.com/extcaspic/164/2135331-97-2.png)
1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl structure
|
Common Name | 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl | ||
|---|---|---|---|---|
| CAS Number | 2135331-97-2 | Molecular Weight | 264.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12ClF3N2 |
|---|---|
| Molecular Weight | 264.67 |
| InChIKey | KJGVXBVHRXRVDN-UHFFFAOYSA-N |
| SMILES | Cl.FC(F)(F)c1ccc(C23CNCC2C3)nc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: InChIKey of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is KJGVXBVHRXRVDN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: Molecular formula of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is C11H12ClF3N2. |
| Q: What is the SMILES notation of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: SMILES notation of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is Cl.FC(F)(F)c1ccc(C23CNCC2C3)nc1. |
| Q: What is the Chinese name of 2135331-97-2? |
| A: Chinese name of 2135331-97-2 is 2135331-97-2. |
| Q: What is the English name of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: The English name of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl. |
| Q: What is the molecular weight of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: Molecular weight of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is 264.67. |
| Q: What is the CAS number of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl? |
| A: CAS number of 1-(5-(Trifluoromethyl)pyridin-2-YL)-3-azabicyclo[3.1.0]hexane hcl is 2135331-97-2. |