Thalidomide-O-PEG3-amine
Modify Date: 2026-07-01 21:58:44
Thalidomide-O-PEG3-amine structure
|
Common Name | Thalidomide-O-PEG3-amine | ||
|---|---|---|---|---|
| CAS Number | 2136248-13-8 | Molecular Weight | 449.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Thalidomide-O-PEG3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H27N3O8 |
|---|---|
| Molecular Weight | 449.5 |
| InChIKey | AGEQHWRRIJUZHD-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Thalidomide-O-PEG3-amine? |
| A: InChIKey of Thalidomide-O-PEG3-amine is AGEQHWRRIJUZHD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Thalidomide-O-PEG3-amine? |
| A: Molecular weight of Thalidomide-O-PEG3-amine is 449.5. |
| Q: What is the Chinese name of 2136248-13-8? |
| A: Chinese name of 2136248-13-8 is 2136248-13-8. |
| Q: What is the English name of Thalidomide-O-PEG3-amine? |
| A: The English name of Thalidomide-O-PEG3-amine is Thalidomide-O-PEG3-amine. |
| Q: What is the CAS number of Thalidomide-O-PEG3-amine? |
| A: CAS number of Thalidomide-O-PEG3-amine is 2136248-13-8. |
| Q: What is the SMILES notation of Thalidomide-O-PEG3-amine? |
| A: SMILES notation of Thalidomide-O-PEG3-amine is NCCOCCOCCOCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O. |
| Q: What is the molecular formula of Thalidomide-O-PEG3-amine? |
| A: Molecular formula of Thalidomide-O-PEG3-amine is C21H27N3O8. |