(8R)-8-Azido-5,6,7,8-tetrahydroquinoline
Modify Date: 2025-09-09 19:38:42
(8R)-8-Azido-5,6,7,8-tetrahydroquinoline structure
|
Common Name | (8R)-8-Azido-5,6,7,8-tetrahydroquinoline | ||
|---|---|---|---|---|
| CAS Number | 2136852-64-5 | Molecular Weight | 174.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (8R)-8-Azido-5,6,7,8-tetrahydroquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N4 |
|---|---|
| Molecular Weight | 174.20 |
| InChIKey | OHRZQMSCHXLGEU-MRVPVSSYSA-N |
| SMILES | [N-]=[N+]=NC1CCCc2cccnc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: Molecular weight of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is 174.20. |
| Q: What is the SMILES notation of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: SMILES notation of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is [N-]=[N+]=NC1CCCc2cccnc21. |
| Q: What is the molecular formula of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: Molecular formula of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is C9H10N4. |
| Q: What is the English name of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: The English name of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is (8R)-8-Azido-5,6,7,8-tetrahydroquinoline. |
| Q: What is the Chinese name of 2136852-64-5? |
| A: Chinese name of 2136852-64-5 is 2136852-64-5. |
| Q: What is the InChIKey of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: InChIKey of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is OHRZQMSCHXLGEU-MRVPVSSYSA-N. |
| Q: What is the CAS number of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline? |
| A: CAS number of (8R)-8-Azido-5,6,7,8-tetrahydroquinoline is 2136852-64-5. |