chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate
Modify Date: 2026-08-14 12:49:05
![chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate Structure](https://www.chemsrc.com/extcaspic/159/2137066-13-6.png)
chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate structure
|
Common Name | chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate | ||
|---|---|---|---|---|
| CAS Number | 2137066-13-6 | Molecular Weight | 252.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H17ClN2O4 |
|---|---|
| Molecular Weight | 252.69 |
| InChIKey | OOSPPKIRNJXESA-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN)C(=O)OCCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: Molecular weight of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is 252.69. |
| Q: What is the CAS number of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: CAS number of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is 2137066-13-6. |
| Q: What is the Chinese name of 2137066-13-6? |
| A: Chinese name of 2137066-13-6 is 2137066-13-6. |
| Q: What is the SMILES notation of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: SMILES notation of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is CC(C)(C)OC(=O)NC(CN)C(=O)OCCl. |
| Q: What is the molecular formula of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: Molecular formula of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is C9H17ClN2O4. |
| Q: What is the English name of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: The English name of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate. |
| Q: What is the InChIKey of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: InChIKey of chloromethyl (2S)-3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoate is OOSPPKIRNJXESA-LURJTMIESA-N. |