5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde
Modify Date: 2026-08-19 12:08:11
![5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde Structure](https://www.chemsrc.com/extcaspic/463/2137143-72-5.png)
5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde structure
|
Common Name | 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2137143-72-5 | Molecular Weight | 195.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13NO3 |
|---|---|
| Molecular Weight | 195.21 |
| InChIKey | ONXCTTOXLVRNKG-ZETCQYMHSA-N |
| SMILES | CC(O)C1CN(c2ccc(C=O)o2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: Molecular weight of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is 195.21. |
| Q: What is the English name of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: The English name of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde. |
| Q: What is the InChIKey of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: InChIKey of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is ONXCTTOXLVRNKG-ZETCQYMHSA-N. |
| Q: What is the CAS number of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: CAS number of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is 2137143-72-5. |
| Q: What is the SMILES notation of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: SMILES notation of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is CC(O)C1CN(c2ccc(C=O)o2)C1. |
| Q: What is the Chinese name of 2137143-72-5? |
| A: Chinese name of 2137143-72-5 is 2137143-72-5. |
| Q: What is the molecular formula of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde? |
| A: Molecular formula of 5-{3-[(1S)-1-hydroxyethyl]azetidin-1-yl}furan-2-carbaldehyde is C10H13NO3. |