N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide
Modify Date: 2025-11-06 19:23:02
![N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide Structure](https://www.chemsrc.com/extcaspic/278/2137145-67-4.png)
N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide structure
|
Common Name | N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2137145-67-4 | Molecular Weight | 273.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO5S |
|---|---|
| Molecular Weight | 273.31 |
| InChIKey | RYGZMJZNEJYYNR-SNVBAGLBSA-N |
| SMILES | O=C(CS(=O)(=O)NCC(O)CO)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: CAS number of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is 2137145-67-4. |
| Q: What is the Chinese name of 2137145-67-4? |
| A: Chinese name of 2137145-67-4 is 2137145-67-4. |
| Q: What is the English name of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: The English name of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide. |
| Q: What is the SMILES notation of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: SMILES notation of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is O=C(CS(=O)(=O)NCC(O)CO)c1ccccc1. |
| Q: What is the molecular formula of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: Molecular formula of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is C11H15NO5S. |
| Q: What is the InChIKey of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: InChIKey of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is RYGZMJZNEJYYNR-SNVBAGLBSA-N. |
| Q: What is the molecular weight of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide? |
| A: Molecular weight of N-[(2R)-2,3-dihydroxypropyl]-2-oxo-2-phenylethane-1-sulfonamide is 273.31. |