4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid
Modify Date: 2025-11-07 19:49:38
![4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid Structure](https://www.chemsrc.com/extcaspic/122/2137146-62-2.png)
4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid structure
|
Common Name | 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2137146-62-2 | Molecular Weight | 343.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17NO6 |
|---|---|
| Molecular Weight | 343.3 |
| InChIKey | ZQFHRPUKKSSLSY-OAHLLOKOSA-N |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)c1ccc(C(=O)O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: InChIKey of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is ZQFHRPUKKSSLSY-OAHLLOKOSA-N. |
| Q: What is the SMILES notation of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: SMILES notation of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is O=C(O)CC(NC(=O)OCc1ccccc1)c1ccc(C(=O)O)cc1. |
| Q: What is the English name of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: The English name of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid. |
| Q: What is the Chinese name of 2137146-62-2? |
| A: Chinese name of 2137146-62-2 is 2137146-62-2. |
| Q: What is the molecular weight of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: Molecular weight of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is 343.3. |
| Q: What is the CAS number of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: CAS number of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is 2137146-62-2. |
| Q: What is the molecular formula of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid? |
| A: Molecular formula of 4-[(1R)-1-{[(benzyloxy)carbonyl]amino}-2-carboxyethyl]benzoic acid is C18H17NO6. |