Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic acid (1:1) structure
|
Common Name | Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 213740-80-8 | Molecular Weight | 892.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H26F17IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, salt with perfluoro-1-octanesulfonic acid (1:1) |
|---|
| Molecular Formula | C28H26F17IO3S |
|---|---|
| Molecular Weight | 892.4 |
| InChIKey | GGKNUPBFZOOSQW-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |