2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid structure
|
Common Name | 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2137458-41-2 | Molecular Weight | 498.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20BrNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H20BrNO6 |
|---|---|
| Molecular Weight | 498.3 |
| InChIKey | CPEWOPGLNWXDMV-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)cc(C(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: The English name of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid. |
| Q: What is the molecular weight of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: Molecular weight of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is 498.3. |
| Q: What is the CAS number of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: CAS number of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is 2137458-41-2. |
| Q: What is the Chinese name of 2137458-41-2? |
| A: Chinese name of 2137458-41-2 is 2137458-41-2. |
| Q: What is the InChIKey of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: InChIKey of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is CPEWOPGLNWXDMV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: SMILES notation of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is COc1cc(Br)cc(C(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c1O. |
| Q: What is the molecular formula of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid? |
| A: Molecular formula of 2-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid is C24H20BrNO6. |