3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid structure
|
Common Name | 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137503-62-7 | Molecular Weight | 437.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H19NO4S2 |
|---|---|
| Molecular Weight | 437.5 |
| InChIKey | VQUFPRMRSAMXHN-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CSC(c2cccs2)N1C(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: InChIKey of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is VQUFPRMRSAMXHN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: Molecular weight of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is 437.5. |
| Q: What is the SMILES notation of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: SMILES notation of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CSC(c2cccs2)N1C(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the CAS number of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: CAS number of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is 2137503-62-7. |
| Q: What is the Chinese name of 2137503-62-7? |
| A: Chinese name of 2137503-62-7 is 2137503-62-7. |
| Q: What is the molecular formula of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: Molecular formula of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is C23H19NO4S2. |
| Q: What is the English name of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid? |
| A: The English name of 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid is 3-{[(9H-fluoren-9-yl)methoxy]carbonyl}-2-(thiophen-2-yl)-1,3-thiazolidine-4-carboxylic acid. |