5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid structure
|
Common Name | 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137530-70-0 | Molecular Weight | 311.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrF2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrF2O2S |
|---|---|
| Molecular Weight | 311.14 |
| InChIKey | RINOJOSBUGWMEA-UHFFFAOYSA-N |
| SMILES | CC1(c2cc(Br)sc2C(=O)O)CC(F)(F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: InChIKey of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is RINOJOSBUGWMEA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: CAS number of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is 2137530-70-0. |
| Q: What is the English name of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: The English name of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid. |
| Q: What is the SMILES notation of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: SMILES notation of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is CC1(c2cc(Br)sc2C(=O)O)CC(F)(F)C1. |
| Q: What is the Chinese name of 2137530-70-0? |
| A: Chinese name of 2137530-70-0 is 2137530-70-0. |
| Q: What is the molecular weight of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: Molecular weight of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is 311.14. |
| Q: What is the molecular formula of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid? |
| A: Molecular formula of 5-Bromo-3-(3,3-difluoro-1-methylcyclobutyl)thiophene-2-carboxylic acid is C10H9BrF2O2S. |