1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione
Modify Date: 2026-07-07 18:56:50
![1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione Structure](https://www.chemsrc.com/extcaspic/233/2137539-01-4.png)
1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione structure
|
Common Name | 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione | ||
|---|---|---|---|---|
| CAS Number | 2137539-01-4 | Molecular Weight | 344.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13IO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13IO4S |
|---|---|
| Molecular Weight | 344.17 |
| InChIKey | LPUURFKSCBEAAO-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CCCS(=O)(=O)C2)C(CI)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: CAS number of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is 2137539-01-4. |
| Q: What is the molecular weight of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: Molecular weight of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is 344.17. |
| Q: What is the molecular formula of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: Molecular formula of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is C9H13IO4S. |
| Q: What is the InChIKey of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: InChIKey of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is LPUURFKSCBEAAO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137539-01-4? |
| A: Chinese name of 2137539-01-4 is 2137539-01-4. |
| Q: What is the SMILES notation of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: SMILES notation of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is O=C1CC2(CCCS(=O)(=O)C2)C(CI)O1. |
| Q: What is the English name of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione? |
| A: The English name of 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione is 1-(Iodomethyl)-2-oxa-7lambda6-thiaspiro[4.5]decane-3,7,7-trione. |