8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one
Modify Date: 2026-09-28 11:56:55
![8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one Structure](https://www.chemsrc.com/extcaspic/418/2137582-64-8.png)
8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one structure
|
Common Name | 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one | ||
|---|---|---|---|---|
| CAS Number | 2137582-64-8 | Molecular Weight | 211.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO2 |
|---|---|
| Molecular Weight | 211.30 |
| InChIKey | JOGSZSFQBZEMTB-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)CC2(CCNC(=O)O2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: The English name of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one. |
| Q: What is the Chinese name of 2137582-64-8? |
| A: Chinese name of 2137582-64-8 is 2137582-64-8. |
| Q: What is the InChIKey of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: InChIKey of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is JOGSZSFQBZEMTB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: Molecular weight of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is 211.30. |
| Q: What is the molecular formula of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: Molecular formula of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is C12H21NO2. |
| Q: What is the CAS number of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: CAS number of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is 2137582-64-8. |
| Q: What is the SMILES notation of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one? |
| A: SMILES notation of 8,8,10-Trimethyl-1-oxa-3-azaspiro[5.5]undecan-2-one is CC1CC(C)(C)CC2(CCNC(=O)O2)C1. |