1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one
Modify Date: 2025-10-12 11:00:56
![1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one Structure](https://www.chemsrc.com/extcaspic/002/2137593-97-4.png)
1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one structure
|
Common Name | 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 2137593-97-4 | Molecular Weight | 234.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N2O |
|---|---|
| Molecular Weight | 234.34 |
| InChIKey | HMBROVOGFLBVOY-UHFFFAOYSA-N |
| SMILES | C#CCCCCC(=O)N1CC2CC(N)CC1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: The English name of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one. |
| Q: What is the Chinese name of 2137593-97-4? |
| A: Chinese name of 2137593-97-4 is 2137593-97-4. |
| Q: What is the InChIKey of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: InChIKey of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is HMBROVOGFLBVOY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: Molecular weight of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is 234.34. |
| Q: What is the molecular formula of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: Molecular formula of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is C14H22N2O. |
| Q: What is the SMILES notation of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: SMILES notation of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is C#CCCCCC(=O)N1CC2CC(N)CC1C2. |
| Q: What is the CAS number of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one? |
| A: CAS number of 1-{3-Amino-6-azabicyclo[3.2.1]octan-6-yl}hept-6-yn-1-one is 2137593-97-4. |