3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid
Modify Date: 2026-08-03 19:49:28
3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid structure
|
Common Name | 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137602-01-6 | Molecular Weight | 254.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O3S |
|---|---|
| Molecular Weight | 254.35 |
| InChIKey | MFFRCRYBNDYACZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(c1cc(C=O)sc1C(=O)O)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: The English name of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid. |
| Q: What is the molecular weight of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: Molecular weight of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is 254.35. |
| Q: What is the CAS number of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: CAS number of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is 2137602-01-6. |
| Q: What is the SMILES notation of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: SMILES notation of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is CC(C)C(c1cc(C=O)sc1C(=O)O)C(C)C. |
| Q: What is the molecular formula of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: Molecular formula of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is C13H18O3S. |
| Q: What is the Chinese name of 2137602-01-6? |
| A: Chinese name of 2137602-01-6 is 2137602-01-6. |
| Q: What is the InChIKey of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid? |
| A: InChIKey of 3-(2,4-Dimethylpentan-3-yl)-5-formylthiophene-2-carboxylic acid is MFFRCRYBNDYACZ-UHFFFAOYSA-N. |