4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde
Modify Date: 2025-11-02 02:02:23
4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde structure
|
Common Name | 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2137611-81-3 | Molecular Weight | 250.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11ClOS |
|---|---|
| Molecular Weight | 250.74 |
| InChIKey | BFQZRQIFMSCFFN-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccc(Cl)s2)c(C)cc1C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: The English name of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde. |
| Q: What is the molecular weight of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: Molecular weight of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is 250.74. |
| Q: What is the Chinese name of 2137611-81-3? |
| A: Chinese name of 2137611-81-3 is 2137611-81-3. |
| Q: What is the InChIKey of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: InChIKey of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is BFQZRQIFMSCFFN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: SMILES notation of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is Cc1cc(-c2ccc(Cl)s2)c(C)cc1C=O. |
| Q: What is the molecular formula of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: Molecular formula of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is C13H11ClOS. |
| Q: What is the CAS number of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde? |
| A: CAS number of 4-(5-Chlorothiophen-2-yl)-2,5-dimethylbenzaldehyde is 2137611-81-3. |