7,8-dichloro-N4-ethylquinoline-3,4-diamine structure
|
Common Name | 7,8-dichloro-N4-ethylquinoline-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 2137616-52-3 | Molecular Weight | 256.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,8-dichloro-N4-ethylquinoline-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11Cl2N3 |
|---|---|
| Molecular Weight | 256.13 |
| InChIKey | LHMYYGOYDDFKDA-UHFFFAOYSA-N |
| SMILES | CCNc1c(N)cnc2c(Cl)c(Cl)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: CAS number of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is 2137616-52-3. |
| Q: What is the InChIKey of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: InChIKey of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is LHMYYGOYDDFKDA-UHFFFAOYSA-N. |
| Q: What is the English name of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: The English name of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is 7,8-dichloro-N4-ethylquinoline-3,4-diamine. |
| Q: What is the molecular formula of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: Molecular formula of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is C11H11Cl2N3. |
| Q: What is the Chinese name of 2137616-52-3? |
| A: Chinese name of 2137616-52-3 is 2137616-52-3. |
| Q: What is the molecular weight of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: Molecular weight of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is 256.13. |
| Q: What is the SMILES notation of 7,8-dichloro-N4-ethylquinoline-3,4-diamine? |
| A: SMILES notation of 7,8-dichloro-N4-ethylquinoline-3,4-diamine is CCNc1c(N)cnc2c(Cl)c(Cl)ccc12. |