5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole
Modify Date: 2025-09-10 10:22:54
5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole structure
|
Common Name | 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole | ||
|---|---|---|---|---|
| CAS Number | 2137653-67-7 | Molecular Weight | 223.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10FNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10FNOS |
|---|---|
| Molecular Weight | 223.27 |
| InChIKey | FPDIWFFSLGFILX-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccc(C)c(F)c2)sn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: SMILES notation of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is COc1cc(-c2ccc(C)c(F)c2)sn1. |
| Q: What is the molecular formula of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: Molecular formula of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is C11H10FNOS. |
| Q: What is the CAS number of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: CAS number of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is 2137653-67-7. |
| Q: What is the molecular weight of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: Molecular weight of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is 223.27. |
| Q: What is the English name of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: The English name of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole. |
| Q: What is the InChIKey of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole? |
| A: InChIKey of 5-(3-Fluoro-4-methylphenyl)-3-methoxy-1,2-thiazole is FPDIWFFSLGFILX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137653-67-7? |
| A: Chinese name of 2137653-67-7 is 2137653-67-7. |