4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde
Modify Date: 2026-08-14 17:51:40
4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde structure
|
Common Name | 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2137656-14-3 | Molecular Weight | 208.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8N2O2S |
|---|---|
| Molecular Weight | 208.24 |
| InChIKey | RNYIPPJXDHZRDQ-UHFFFAOYSA-N |
| SMILES | Cc1coc(-c2sc(C=O)nc2C)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: Molecular formula of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is C9H8N2O2S. |
| Q: What is the SMILES notation of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: SMILES notation of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is Cc1coc(-c2sc(C=O)nc2C)n1. |
| Q: What is the Chinese name of 2137656-14-3? |
| A: Chinese name of 2137656-14-3 is 2137656-14-3. |
| Q: What is the CAS number of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: CAS number of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is 2137656-14-3. |
| Q: What is the InChIKey of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: InChIKey of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is RNYIPPJXDHZRDQ-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: The English name of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde. |
| Q: What is the molecular weight of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde? |
| A: Molecular weight of 4-Methyl-5-(4-methyl-1,3-oxazol-2-yl)-1,3-thiazole-2-carbaldehyde is 208.24. |