1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid
Modify Date: 2026-07-04 10:47:08
![1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/297/2137660-76-3.png)
1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid structure
|
Common Name | 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137660-76-3 | Molecular Weight | 405.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H27NO4 |
|---|---|
| Molecular Weight | 405.5 |
| InChIKey | KIRXMZXVWDUNTP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)C2CCCCC12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: Molecular formula of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is C25H27NO4. |
| Q: What is the molecular weight of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: Molecular weight of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is 405.5. |
| Q: What is the SMILES notation of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: SMILES notation of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is O=C(O)C1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)C2CCCCC12. |
| Q: What is the English name of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: The English name of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid. |
| Q: What is the CAS number of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: CAS number of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is 2137660-76-3. |
| Q: What is the InChIKey of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid? |
| A: InChIKey of 1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-decahydroquinoline-4-carboxylic acid is KIRXMZXVWDUNTP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137660-76-3? |
| A: Chinese name of 2137660-76-3 is 2137660-76-3. |