7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine structure
|
Common Name | 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2137687-67-1 | Molecular Weight | 284.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10BrNOS |
|---|---|
| Molecular Weight | 284.17 |
| InChIKey | BSFJTSDLSUHKLZ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(C2NCCc3ccoc32)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: The English name of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine. |
| Q: What is the molecular weight of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: Molecular weight of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 284.17. |
| Q: What is the Chinese name of 2137687-67-1? |
| A: Chinese name of 2137687-67-1 is 2137687-67-1. |
| Q: What is the InChIKey of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: InChIKey of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is BSFJTSDLSUHKLZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: Molecular formula of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is C11H10BrNOS. |
| Q: What is the CAS number of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: CAS number of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 2137687-67-1. |
| Q: What is the SMILES notation of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: SMILES notation of 7-(5-bromothiophen-2-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is Brc1ccc(C2NCCc3ccoc32)s1. |