5,7-Dibromo-2,4-dimethylquinoline
Modify Date: 2025-10-13 18:36:34
5,7-Dibromo-2,4-dimethylquinoline structure
|
Common Name | 5,7-Dibromo-2,4-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 2137689-38-2 | Molecular Weight | 315.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-Dibromo-2,4-dimethylquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9Br2N |
|---|---|
| Molecular Weight | 315.00 |
| InChIKey | MIXJTEBZPBOMFG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(Br)cc(Br)cc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: Molecular weight of 5,7-Dibromo-2,4-dimethylquinoline is 315.00. |
| Q: What is the SMILES notation of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: SMILES notation of 5,7-Dibromo-2,4-dimethylquinoline is Cc1cc(C)c2c(Br)cc(Br)cc2n1. |
| Q: What is the Chinese name of 2137689-38-2? |
| A: Chinese name of 2137689-38-2 is 2137689-38-2. |
| Q: What is the molecular formula of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: Molecular formula of 5,7-Dibromo-2,4-dimethylquinoline is C11H9Br2N. |
| Q: What is the English name of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: The English name of 5,7-Dibromo-2,4-dimethylquinoline is 5,7-Dibromo-2,4-dimethylquinoline. |
| Q: What is the CAS number of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: CAS number of 5,7-Dibromo-2,4-dimethylquinoline is 2137689-38-2. |
| Q: What is the InChIKey of 5,7-Dibromo-2,4-dimethylquinoline? |
| A: InChIKey of 5,7-Dibromo-2,4-dimethylquinoline is MIXJTEBZPBOMFG-UHFFFAOYSA-N. |