5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid
Modify Date: 2026-07-29 12:29:15
5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid structure
|
Common Name | 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137696-39-8 | Molecular Weight | 238.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O3S |
|---|---|
| Molecular Weight | 238.27 |
| InChIKey | SAKHIWSBQMOQFY-UHFFFAOYSA-N |
| SMILES | CCc1onc(-c2csc(C)n2)c1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: InChIKey of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is SAKHIWSBQMOQFY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137696-39-8? |
| A: Chinese name of 2137696-39-8 is 2137696-39-8. |
| Q: What is the CAS number of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: CAS number of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is 2137696-39-8. |
| Q: What is the English name of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: The English name of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid. |
| Q: What is the molecular formula of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: Molecular formula of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is C10H10N2O3S. |
| Q: What is the SMILES notation of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: SMILES notation of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is CCc1onc(-c2csc(C)n2)c1C(=O)O. |
| Q: What is the molecular weight of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid? |
| A: Molecular weight of 5-Ethyl-3-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-4-carboxylic acid is 238.27. |