3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid
Modify Date: 2026-09-23 20:11:21
3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid structure
|
Common Name | 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137697-73-3 | Molecular Weight | 240.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12O4S |
|---|---|
| Molecular Weight | 240.28 |
| InChIKey | DXXUPCJZZMOUAU-UHFFFAOYSA-N |
| SMILES | CC1(c2cc(C(=O)O)sc2C(=O)O)CCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2137697-73-3? |
| A: Chinese name of 2137697-73-3 is 2137697-73-3. |
| Q: What is the InChIKey of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: InChIKey of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is DXXUPCJZZMOUAU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: Molecular weight of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is 240.28. |
| Q: What is the SMILES notation of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: SMILES notation of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is CC1(c2cc(C(=O)O)sc2C(=O)O)CCC1. |
| Q: What is the CAS number of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: CAS number of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is 2137697-73-3. |
| Q: What is the English name of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: The English name of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid. |
| Q: What is the molecular formula of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid? |
| A: Molecular formula of 3-(1-Methylcyclobutyl)thiophene-2,5-dicarboxylic acid is C11H12O4S. |