1-{6-Ethylspiro[2.5]octan-6-yl}piperazine
Modify Date: 2026-07-31 06:46:36
![1-{6-Ethylspiro[2.5]octan-6-yl}piperazine Structure](https://www.chemsrc.com/extcaspic/051/2137721-32-3.png)
1-{6-Ethylspiro[2.5]octan-6-yl}piperazine structure
|
Common Name | 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine | ||
|---|---|---|---|---|
| CAS Number | 2137721-32-3 | Molecular Weight | 222.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26N2 |
|---|---|
| Molecular Weight | 222.37 |
| InChIKey | PZCQEYKHUGLWRK-UHFFFAOYSA-N |
| SMILES | CCC1(N2CCNCC2)CCC2(CC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: Molecular weight of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is 222.37. |
| Q: What is the English name of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: The English name of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine. |
| Q: What is the SMILES notation of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: SMILES notation of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is CCC1(N2CCNCC2)CCC2(CC2)CC1. |
| Q: What is the Chinese name of 2137721-32-3? |
| A: Chinese name of 2137721-32-3 is 2137721-32-3. |
| Q: What is the InChIKey of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: InChIKey of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is PZCQEYKHUGLWRK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: CAS number of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is 2137721-32-3. |
| Q: What is the molecular formula of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine? |
| A: Molecular formula of 1-{6-Ethylspiro[2.5]octan-6-yl}piperazine is C14H26N2. |