(2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine
Modify Date: 2026-09-28 18:38:04
![(2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine Structure](https://www.chemsrc.com/extcaspic/182/2137727-88-7.png)
(2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine structure
|
Common Name | (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine | ||
|---|---|---|---|---|
| CAS Number | 2137727-88-7 | Molecular Weight | 237.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23NS |
|---|---|
| Molecular Weight | 237.41 |
| InChIKey | DNYAKGDLTKCZAT-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NCc1ccc(CSC)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: InChIKey of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is DNYAKGDLTKCZAT-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: CAS number of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is 2137727-88-7. |
| Q: What is the English name of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: The English name of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine. |
| Q: What is the molecular weight of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: Molecular weight of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is 237.41. |
| Q: What is the Chinese name of 2137727-88-7? |
| A: Chinese name of 2137727-88-7 is 2137727-88-7. |
| Q: What is the SMILES notation of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: SMILES notation of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is CCC(C)(C)NCc1ccc(CSC)cc1. |
| Q: What is the molecular formula of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine? |
| A: Molecular formula of (2-Methylbutan-2-yl)({4-[(methylsulfanyl)methyl]phenyl}methyl)amine is C14H23NS. |