N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide
Modify Date: 2025-10-19 14:11:55
![N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide Structure](https://www.chemsrc.com/extcaspic/019/2137743-37-2.png)
N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide structure
|
Common Name | N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 2137743-37-2 | Molecular Weight | 308.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17ClN4O2 |
|---|---|
| Molecular Weight | 308.76 |
| InChIKey | JCUKWKYUBKVILM-UHFFFAOYSA-N |
| SMILES | COCC(Cl)c1cnnn1CC(=O)NCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: Molecular formula of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is C14H17ClN4O2. |
| Q: What is the molecular weight of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: Molecular weight of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is 308.76. |
| Q: What is the English name of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: The English name of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide. |
| Q: What is the CAS number of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: CAS number of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is 2137743-37-2. |
| Q: What is the SMILES notation of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: SMILES notation of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is COCC(Cl)c1cnnn1CC(=O)NCc1ccccc1. |
| Q: What is the Chinese name of 2137743-37-2? |
| A: Chinese name of 2137743-37-2 is 2137743-37-2. |
| Q: What is the InChIKey of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide? |
| A: InChIKey of N-benzyl-2-[5-(1-chloro-2-methoxyethyl)-1H-1,2,3-triazol-1-yl]acetamide is JCUKWKYUBKVILM-UHFFFAOYSA-N. |