2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol
![2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol Structure](https://image.chemsrc.com/caspic/193/213775-52-1.png)
2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol structure
|
Common Name | 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 213775-52-1 | Molecular Weight | 326.47600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H30N2O |
|---|---|
| Molecular Weight | 326.47600 |
| Exact Mass | 326.23600 |
| PSA | 45.15000 |
| LogP | 5.06290 |
| InChIKey | OHBYIVYYMGLEQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CNCc2ccccn2)c(O)c(C(C)(C)C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
2,4-ditert-buty... CAS#:213775-52-1 |
| Literature: Motoyama, Takeshi; Shimazaki, Yuichi; Yajima, Tatsuo; Nakabayashi, Yasuo; Naruta, Yoshinori; Yamauchi, Osamu Journal of the American Chemical Society, 2004 , vol. 126, # 23 p. 7378 - 7385 |
|
~%
2,4-ditert-buty... CAS#:213775-52-1 |
| Literature: Wong, Yee-Lok; Yan, Yan; Chan, Edith S. H.; Yang, Qingchuan; Mak, Thomas C. W.; Ng, Dennis K. P. Journal of the Chemical Society - Dalton Transactions, 1998 , # 18 p. 3057 - 3064 |
|
~%
2,4-ditert-buty... CAS#:213775-52-1 |
| Literature: Wong, Yee-Lok; Yan, Yan; Chan, Edith S. H.; Yang, Qingchuan; Mak, Thomas C. W.; Ng, Dennis K. P. Journal of the Chemical Society - Dalton Transactions, 1998 , # 18 p. 3057 - 3064 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: Related upstream materials(CAS) of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol: 3731-51-9;37942-07-7. |
| Q: What is the CAS number of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: CAS number of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is 213775-52-1. |
| Q: What is the molecular weight of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: Molecular weight of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is 326.47600. |
| Q: What is the molecular formula of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: Molecular formula of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is C21H30N2O. |
| Q: What is the Chinese name of 213775-52-1? |
| A: Chinese name of 213775-52-1 is 213775-52-1. |
| Q: What is the InChIKey of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: InChIKey of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is OHBYIVYYMGLEQY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: SMILES notation of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is CC(C)(C)c1cc(CNCc2ccccn2)c(O)c(C(C)(C)C)c1. |
| Q: What is the LogP of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: LogP of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is 5.06290. |
| Q: What is the English name of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: The English name of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol. |
| Q: What is the polar surface area (PSA) of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol? |
| A: Polar surface area (PSA) of 2,4-ditert-butyl-6-[(pyridin-2-ylmethylamino)methyl]phenol is 45.15000. |