N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide structure
|
Common Name | N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 2137752-32-8 | Molecular Weight | 274.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15ClN2O2S |
|---|---|
| Molecular Weight | 274.77 |
| InChIKey | MQJLUMDPXRASTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(Cl)=NC(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: InChIKey of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is MQJLUMDPXRASTJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: SMILES notation of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is CC(=O)Nc1ccc(S(=O)(Cl)=NC(C)C)cc1. |
| Q: What is the molecular weight of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: Molecular weight of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is 274.77. |
| Q: What is the Chinese name of 2137752-32-8? |
| A: Chinese name of 2137752-32-8 is 2137752-32-8. |
| Q: What is the CAS number of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: CAS number of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is 2137752-32-8. |
| Q: What is the molecular formula of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: Molecular formula of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is C11H15ClN2O2S. |
| Q: What is the English name of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide? |
| A: The English name of N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide is N-{4-[chloro(oxo)[(propan-2-yl)imino]-lambda6-sulfanyl]phenyl}acetamide. |