N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide
Modify Date: 2025-09-22 18:06:18
N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide structure
|
Common Name | N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide | ||
|---|---|---|---|---|
| CAS Number | 2137759-67-0 | Molecular Weight | 250.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11F5N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11F5N2O2 |
|---|---|
| Molecular Weight | 250.17 |
| InChIKey | YFKHMGXOACIBED-UHFFFAOYSA-N |
| SMILES | COCC(=O)NCC(N)C(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: Molecular formula of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is C7H11F5N2O2. |
| Q: What is the InChIKey of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: InChIKey of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is YFKHMGXOACIBED-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137759-67-0? |
| A: Chinese name of 2137759-67-0 is 2137759-67-0. |
| Q: What is the CAS number of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: CAS number of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is 2137759-67-0. |
| Q: What is the molecular weight of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: Molecular weight of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is 250.17. |
| Q: What is the SMILES notation of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: SMILES notation of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is COCC(=O)NCC(N)C(F)(F)C(F)(F)F. |
| Q: What is the English name of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide? |
| A: The English name of N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide is N-(2-amino-3,3,4,4,4-pentafluorobutyl)-2-methoxyacetamide. |