4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid
Modify Date: 2025-09-17 22:29:55
![4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/084/2137774-77-5.png)
4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid structure
|
Common Name | 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2137774-77-5 | Molecular Weight | 430.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H20BrNO4 |
|---|---|
| Molecular Weight | 430.3 |
| InChIKey | YGZREOUEPYDRAT-UHFFFAOYSA-N |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(Br)(C(=O)O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: InChIKey of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is YGZREOUEPYDRAT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2137774-77-5? |
| A: Chinese name of 2137774-77-5 is 2137774-77-5. |
| Q: What is the SMILES notation of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: SMILES notation of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(Br)(C(=O)O)CC1. |
| Q: What is the CAS number of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: CAS number of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is 2137774-77-5. |
| Q: What is the English name of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: The English name of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid. |
| Q: What is the molecular formula of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: Molecular formula of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is C21H20BrNO4. |
| Q: What is the molecular weight of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid? |
| A: Molecular weight of 4-bromo-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-4-carboxylic acid is 430.3. |