2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate
Modify Date: 2025-09-07 14:06:46
2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate structure
|
Common Name | 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2137786-65-1 | Molecular Weight | 302.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8F6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H8F6O4S |
|---|---|
| Molecular Weight | 302.19 |
| InChIKey | QUELMKIPWFZXNG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OC(C1CCOC1)C(F)(F)F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: The English name of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate. |
| Q: What is the molecular weight of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: Molecular weight of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is 302.19. |
| Q: What is the SMILES notation of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: SMILES notation of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is O=S(=O)(OC(C1CCOC1)C(F)(F)F)C(F)(F)F. |
| Q: What is the Chinese name of 2137786-65-1? |
| A: Chinese name of 2137786-65-1 is 2137786-65-1. |
| Q: What is the InChIKey of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: InChIKey of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is QUELMKIPWFZXNG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: Molecular formula of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is C7H8F6O4S. |
| Q: What is the CAS number of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate? |
| A: CAS number of 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is 2137786-65-1. |