4-Chloro-2,5,6-trimethylquinazoline
Modify Date: 2025-09-23 10:09:51
4-Chloro-2,5,6-trimethylquinazoline structure
|
Common Name | 4-Chloro-2,5,6-trimethylquinazoline | ||
|---|---|---|---|---|
| CAS Number | 2137808-60-5 | Molecular Weight | 206.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-2,5,6-trimethylquinazoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClN2 |
|---|---|
| Molecular Weight | 206.67 |
| InChIKey | REJFSLWULLJTKV-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c2c(C)c(C)ccc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: Molecular weight of 4-Chloro-2,5,6-trimethylquinazoline is 206.67. |
| Q: What is the Chinese name of 2137808-60-5? |
| A: Chinese name of 2137808-60-5 is 2137808-60-5. |
| Q: What is the SMILES notation of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: SMILES notation of 4-Chloro-2,5,6-trimethylquinazoline is Cc1nc(Cl)c2c(C)c(C)ccc2n1. |
| Q: What is the English name of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: The English name of 4-Chloro-2,5,6-trimethylquinazoline is 4-Chloro-2,5,6-trimethylquinazoline. |
| Q: What is the InChIKey of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: InChIKey of 4-Chloro-2,5,6-trimethylquinazoline is REJFSLWULLJTKV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: CAS number of 4-Chloro-2,5,6-trimethylquinazoline is 2137808-60-5. |
| Q: What is the molecular formula of 4-Chloro-2,5,6-trimethylquinazoline? |
| A: Molecular formula of 4-Chloro-2,5,6-trimethylquinazoline is C11H11ClN2. |