N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide
Modify Date: 2026-09-20 14:53:56
![N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide Structure](https://www.chemsrc.com/extcaspic/457/2137839-89-3.png)
N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide structure
|
Common Name | N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2137839-89-3 | Molecular Weight | 246.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H22N2O2S |
|---|---|
| Molecular Weight | 246.37 |
| InChIKey | HUFGKCXKJKNWNA-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)NC1CC2CNC(C2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: CAS number of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is 2137839-89-3. |
| Q: What is the InChIKey of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: InChIKey of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is HUFGKCXKJKNWNA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: Molecular weight of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is 246.37. |
| Q: What is the SMILES notation of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: SMILES notation of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is CCCCS(=O)(=O)NC1CC2CNC(C2)C1. |
| Q: What is the molecular formula of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: Molecular formula of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is C11H22N2O2S. |
| Q: What is the Chinese name of 2137839-89-3? |
| A: Chinese name of 2137839-89-3 is 2137839-89-3. |
| Q: What is the English name of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide? |
| A: The English name of N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide is N-{6-azabicyclo[3.2.1]octan-3-yl}butane-1-sulfonamide. |