Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride structure
|
Common Name | Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2137886-77-0 | Molecular Weight | 241.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11ClF3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11ClF3N3 |
|---|---|
| Molecular Weight | 241.64 |
| InChIKey | GSSRXXGDSWHMQZ-UHFFFAOYSA-N |
| SMILES | CNCCc1nccc(C(F)(F)F)n1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: Molecular weight of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is 241.64. |
| Q: What is the InChIKey of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: InChIKey of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is GSSRXXGDSWHMQZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: SMILES notation of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is CNCCc1nccc(C(F)(F)F)n1.Cl. |
| Q: What is the CAS number of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: CAS number of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is 2137886-77-0. |
| Q: What is the Chinese name of 2137886-77-0? |
| A: Chinese name of 2137886-77-0 is 2137886-77-0. |
| Q: What is the English name of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: The English name of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride. |
| Q: What is the molecular formula of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride? |
| A: Molecular formula of Methyl({2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl})amine hydrochloride is C8H11ClF3N3. |