1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one
Modify Date: 2026-07-10 11:55:26
![1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one Structure](https://www.chemsrc.com/extcaspic/245/2137900-31-1.png)
1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one structure
|
Common Name | 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2137900-31-1 | Molecular Weight | 252.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.31 |
| InChIKey | IAIGYXBHKHXTKB-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(-c2ccc(C3CCO3)cc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: Molecular formula of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is C17H16O2. |
| Q: What is the CAS number of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: CAS number of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is 2137900-31-1. |
| Q: What is the molecular weight of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: Molecular weight of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is 252.31. |
| Q: What is the SMILES notation of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: SMILES notation of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is CC(=O)c1cccc(-c2ccc(C3CCO3)cc2)c1. |
| Q: What is the English name of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: The English name of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one. |
| Q: What is the Chinese name of 2137900-31-1? |
| A: Chinese name of 2137900-31-1 is 2137900-31-1. |
| Q: What is the InChIKey of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one? |
| A: InChIKey of 1-{3-[4-(Oxetan-2-yl)phenyl]phenyl}ethan-1-one is IAIGYXBHKHXTKB-UHFFFAOYSA-N. |