5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine
Modify Date: 2025-10-03 13:23:16
![5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine Structure](https://www.chemsrc.com/extcaspic/038/2137958-76-8.png)
5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine structure
|
Common Name | 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2137958-76-8 | Molecular Weight | 239.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14ClN3O |
|---|---|
| Molecular Weight | 239.70 |
| InChIKey | DFKKMQHBSSTFLI-UHFFFAOYSA-N |
| SMILES | CCCc1cc(Cl)n2nc(COC)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular weight of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is 239.70. |
| Q: What is the Chinese name of 2137958-76-8? |
| A: Chinese name of 2137958-76-8 is 2137958-76-8. |
| Q: What is the molecular formula of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular formula of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is C11H14ClN3O. |
| Q: What is the SMILES notation of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: SMILES notation of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is CCCc1cc(Cl)n2nc(COC)nc2c1. |
| Q: What is the InChIKey of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: InChIKey of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is DFKKMQHBSSTFLI-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: The English name of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine. |
| Q: What is the CAS number of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine? |
| A: CAS number of 5-Chloro-2-(methoxymethyl)-7-propyl-[1,2,4]triazolo[1,5-a]pyridine is 2137958-76-8. |