5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one
Modify Date: 2026-07-06 13:38:01
5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one structure
|
Common Name | 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2137959-08-9 | Molecular Weight | 210.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18N2O2 |
|---|---|
| Molecular Weight | 210.27 |
| InChIKey | YXPFDMPTARJPQU-UHFFFAOYSA-N |
| SMILES | Cc1c(N)ccc(=O)n1CC(C)(C)CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: SMILES notation of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is Cc1c(N)ccc(=O)n1CC(C)(C)CO. |
| Q: What is the CAS number of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: CAS number of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is 2137959-08-9. |
| Q: What is the Chinese name of 2137959-08-9? |
| A: Chinese name of 2137959-08-9 is 2137959-08-9. |
| Q: What is the molecular formula of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: Molecular formula of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is C11H18N2O2. |
| Q: What is the molecular weight of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: Molecular weight of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is 210.27. |
| Q: What is the English name of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: The English name of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one. |
| Q: What is the InChIKey of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one? |
| A: InChIKey of 5-Amino-1-(3-hydroxy-2,2-dimethylpropyl)-6-methyl-1,2-dihydropyridin-2-one is YXPFDMPTARJPQU-UHFFFAOYSA-N. |