ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate
Modify Date: 2025-11-04 14:51:20
ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2137990-64-6 | Molecular Weight | 220.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12N4O2 |
|---|---|
| Molecular Weight | 220.23 |
| InChIKey | LQWMXQMJFNIBEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1n[nH]nc1-c1c[nH]cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2137990-64-6? |
| A: Chinese name of 2137990-64-6 is 2137990-64-6. |
| Q: What is the CAS number of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is 2137990-64-6. |
| Q: What is the molecular formula of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is C10H12N4O2. |
| Q: What is the SMILES notation of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is CCOC(=O)c1n[nH]nc1-c1c[nH]cc1C. |
| Q: What is the molecular weight of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is 220.23. |
| Q: What is the English name of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the InChIKey of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of ethyl 5-(4-methyl-1H-pyrrol-3-yl)-1H-1,2,3-triazole-4-carboxylate is LQWMXQMJFNIBEQ-UHFFFAOYSA-N. |