3-Dimethylamino-1-(3-nitrophenyl)propan-1-one structure
|
Common Name | 3-Dimethylamino-1-(3-nitrophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2138-39-8 | Molecular Weight | 222.24000 | |
| Density | 1.172g/cm3 | Boiling Point | 313.5ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 3-(dimethylamino)-1-(3-nitrophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 143.4ºC |
| Exact Mass | 222.10000 |
| PSA | 66.13000 |
| LogP | 2.25240 |
| Vapour Pressure | 0.000496mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | SJICOWGLWXIDAC-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1cccc([N+](=O)[O-])c1 |
|
~%
3-Dimethylamino... CAS#:2138-39-8 |
| Literature: Mannich; Dannehl Archiv der Pharmazie (Weinheim, Germany), 1938 , vol. 276, p. 206,208 |
|
~%
3-Dimethylamino... CAS#:2138-39-8 |
| Literature: Huang, Yunsheng; Hall, Iris H. Archiv der Pharmazie, 1996 , vol. 329, # 7 p. 339 - 346 |
|
Name: Inhibition of Staphylococcus aureus sortase A at 10 ng
Source: ChEMBL
Target: Class A sortase SrtA
External Id: CHEMBL939299
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 1-dimethylamino-3-(3-nitrophenyl)propan-3-one |
| 3-dimethylamino-1-(3-nitro-phenyl)-propan-1-one |
| 2-Propen-1-one,3-(dimethylamino)-1-(3-methoxyphenyl) |
| 3-Dimethylamino-1-(3-nitro-phenyl)-propan-1-on |
| 3-dimethylamino-1-(3-methoxyphenyl)propenone |