1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione
Modify Date: 2026-08-22 20:18:28
![1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione Structure](https://www.chemsrc.com/extcaspic/260/2138005-74-8.png)
1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione structure
|
Common Name | 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione | ||
|---|---|---|---|---|
| CAS Number | 2138005-74-8 | Molecular Weight | 308.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13IO3 |
|---|---|
| Molecular Weight | 308.11 |
| InChIKey | XRXOKIHFUXLYEQ-UHFFFAOYSA-N |
| SMILES | O=C1CCC2(CC1)CC(=O)OC2CI |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: Molecular weight of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is 308.11. |
| Q: What is the InChIKey of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: InChIKey of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is XRXOKIHFUXLYEQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: Molecular formula of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is C10H13IO3. |
| Q: What is the Chinese name of 2138005-74-8? |
| A: Chinese name of 2138005-74-8 is 2138005-74-8. |
| Q: What is the CAS number of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: CAS number of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is 2138005-74-8. |
| Q: What is the English name of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: The English name of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione. |
| Q: What is the SMILES notation of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione? |
| A: SMILES notation of 1-(Iodomethyl)-2-oxaspiro[4.5]decane-3,8-dione is O=C1CCC2(CC1)CC(=O)OC2CI. |