{[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine
Modify Date: 2026-07-04 10:08:57
![{[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine Structure](https://www.chemsrc.com/extcaspic/374/2138011-02-4.png)
{[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine structure
|
Common Name | {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine | ||
|---|---|---|---|---|
| CAS Number | 2138011-02-4 | Molecular Weight | 237.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20FNO |
|---|---|
| Molecular Weight | 237.31 |
| InChIKey | MDSDNLJFPMURCF-UHFFFAOYSA-N |
| SMILES | C=C(OCC)c1ccc(F)c(CNCCC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: SMILES notation of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is C=C(OCC)c1ccc(F)c(CNCCC)c1. |
| Q: What is the Chinese name of 2138011-02-4? |
| A: Chinese name of 2138011-02-4 is 2138011-02-4. |
| Q: What is the CAS number of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: CAS number of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is 2138011-02-4. |
| Q: What is the molecular weight of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: Molecular weight of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is 237.31. |
| Q: What is the molecular formula of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: Molecular formula of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is C14H20FNO. |
| Q: What is the InChIKey of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: InChIKey of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is MDSDNLJFPMURCF-UHFFFAOYSA-N. |
| Q: What is the English name of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine? |
| A: The English name of {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine is {[5-(1-Ethoxyethenyl)-2-fluorophenyl]methyl}(propyl)amine. |